NEW ZEALAND AIRCRAFT REGISTER
Compiled by David Wise
Back to NZ Register Index
Back to ZK-RIA to RZZ
ZK-SAA to ZK-SZZ
Reg ZK- |
Issue | Reg date |
Type | Const Number |
History |
SAA | 1 | 5/07 | C208B | 208B0862 | ex N208DG/N5192E current |
SAB | 1 | 6/93 | Rans S-14 Airaile | 0892037 | to ??? cx 9/98 |
SAC | 1 | 7/98 | C-R182 | 00331 | ex VH-ITW/N4157C cr Matapouri 12/00 rems at Pikes Point cx 9/01 |
SAE | 1 | 6/74 | Argosy 222 | 6802 | ex CF-TAJ/G-ASXN wfu 9/90 Blenheim cx 10/90 pres at cafe nr Woodbourne 3/00-2019+ |
SAE | 2 | 9/04 | Gippsland GA-8 Airvan | GA8-02-055 | ex VH-VFF (op Air Safaris - Tekapo) current |
SAF | 1 | 10/73 | Argosy 222 | 6801 | ex CF-TAG/EI-AVJ/CF-TAG/G-ASXM wfu 4/90 Blenheim cx 10/90 derelict on farm East Blenheim 3/00 |
SAF | 2 | 11/02 | Gippsland GA-8 Airvan | GA8-02-017 | ex VH-AAP (op Air Safaris - Tekapo) rereg ZK-FSS cx 12/16 then ZK-ORC |
SAH | 1 | 9/07 | ICP MXP-740 Savannah | 06-07-51-501 | current |
SAI | 1 | 11/00 | Challenger II | CH2-1099-B-1917 | current |
SAJ | 1 | 5/94 | Fu24-950M | 133 | ex VH-DCM/ZK-CTQ (scr by 1/13) revoked cx 10/13 |
SAJ | 2 | 3/18 | Aeroprakt A-22LS | 310 | current |
SAK | 1 | 8/07 | Micro B22J Bantam | 07-315 | current |
SAL | 1 | 7/81 | GAF N22B Nomad | 35 | ex VH-BFH/OY-ATU/VH-BFH to VH-BFH cx 8/83 cr 1/85 >pres Queensland Museum, Brisbane |
SAL | 2 | 5/90 | Argosy 222 | 6805 | ex VH-IPB/TR-LWR/CF-TAZ/G-ATTC to VH-IPB cx 9/90 scr 12/90 |
SAL | 3 | 8/93 | C172N | 73454 | ex VH-JYI/N4907G to ZK-KAS cx 11/94 |
SAL | 4 | 11/04 | C207 | 20700171 | ex VH-GKZ/P2-SEB/P2-GKU/VH-GKU/VH-UBR/(N1571U) rereg ZK-MDZ cx 10/09 |
SAL | 5 | 5/14 | TL-2000 Sting | 14ST411 | current |
SAL | 0 | Douglas C-47B-35-DK | 16568/33316 | ZK-AZL in false marks pres static at Te Kowhai | |
SAM | 1 | 10/81 | Stolp V-Star | AACA/437/1 | wfu cx 12/01 reb rest 1/05 as ZK-MIJ |
SAM | 2 | 12/02 | Micro B22J Bantam | 02-0207 | rereg ZK-SBD cx 10/08 |
SAM | 3 | 10/08 | Tecnam P96 Golf | 177 | ex ZK-DMT rereg ZK-ELG cx 5/19 |
SAM | 4 | 12/19 | BRM Bristell NG5 | 455/2019 | (f/f 12/19) current |
SAN | 1 | 9/09 | C172S | 172S8673 | ex ZK-NHM/N741SP (op Soundsair) rereg ZK-VBF cx 6/13 |
SAN | 2 | 6/13 | C208 | 20800360 | ex ZK-TZR/N800RA current |
SAP | 1 | 7/93 | Facet Sapphire | MAANZ/486 | ex ZK-MAI(1) current |
SAQ | 1 | 8/07 | Fly Synthesis Storch S | 420A-364 | current |
SAR | 1 | 7/93 | C172M | 62095 | ex N12586 to ZK-JNP cx 3/02 |
SAR | 2 | 3/02 | C182R | 18268212 | ex ZK-JFI/P2-BPD/VH-BPD/N280SF/N2809E rereg ZK-CNR cx 4/11 |
SAR | 3 | 4/11 | C182T | 18282277 | ex N90844 current |
SAS | 1 | 11/04 | P51D-20NT Mustang | 111-36299 | ex N5551D/N9200N/N9002N/VH-CVA/A68-674/44-13016 (marked 472060 LH-X) to VH-LUI cx 6/22 |
SAT | 1 | 12/95 | AT-402B | 402B-0990 | ex N1010Y current |
SAU | 1 | 10/09 | Gippsland GA-8-TC 320 | GA8-TC 320-09-144 | (op Air Safaris) current |
SAV | 1 | 11/04 | ICP Savannah | 04-02-51-277 | current |
SAW | 1 | 12/14 | C208B | 208B2087 | ex N771AL rereg ZK-SDD cx 10/18 |
SAX | 1 | 12/00 | DHC-1 Chipmunk | C1/0566 | ex ZS-USM/ZS-IZW/G-BBWJ/WK551 (cx from ZS-USM 2/82 long rebuild) (marked WK551) current b Palmerston North |
SAY | 1 | 5/08 | Roko Aero NG-4 ML | 0001 | ex I-9528/OK-NUR to VH-24-7357 cx 1/10 |
SAY | 2 | 7/13 | C208B | 208B0861 | ex ZK-MJL/N861CM/N51896 (op Sounds Air) current |
SAZ | 1 | 10/05 | Gippsland GA-8 Airvan | GA8-05-78 | (op Air Safaris, Tekapo) current |
SBB | 1 | 8/06 | C182N | 18260630 | ex VH-DXK/N9090G current |
SBD | 1 | 10/08 | Micro B22J Bantam | 02-0207 | ex ZK-SAM current |
SBI | 1 | 2/05 | Steelworks Skyboard | 10-1-05 | revoked cx 6/15 |
SBJ | 1 | 1/79 | C172N | 17268021 | ex N75893 dest cx 8/00 st dism Timaru 4/01-4/03 |
SBJ | 2 | 10/16 | Vans RV7 | 70566 | current |
SBK | 1 | 4/95 | C172P | 75566 | ex C-GPSZ/(N64496) cr Lake Ellesmere 11/19 cx 2/20 |
SBL | 1 | 11/95 | C172P | 17275844 | ex N65738 current |
SBR | 1 | 10/90 | B22 Bantam | 0099 | current |
SBT | 1 | 3/11 | Vintage Aviator Sopwith 7F.1 Snipe rep | 0009 | marked E8102 to N6313S cx 12/11 |
SBV | 1 | 6/18 | DHC2 Beaver | 763 | (res 3/17) ex VH-ACZ/VH-SYS/C-FHXX current |
SBW | 1 | 1/10 | Skyboard Coba K Whisper | SBW03002 | revoked cx 6/15 |
SBX | 1 | 1/10 | Skyboard Coba K Black | SBX03001 | revoked cx 6/15 |
SBY | 1 | 10/13 | Vintage Aviator Sopwith 7F-1 Snipe rep | 0014 | current marked E7643 b TVA, Masterton |
SBZ | 1 | 8/14 | Europa Classic UL | 240 | ex (ZK-OWN ntu) current |
SCA | 1 | 2/08 | Zlin Aviation Savage | 0115 | current |
SCB | 1 | 11/94 | C180K | 53170 | ex G-OPIX/N186MA/N13720 current |
SCC | 1 | 12/08 | Zenair CH-701 STOL | 7-6592 | current |
SCD | 1 | 5/05 | Tecnam P2002 Sierra | 099 | current |
SCH | 1 | 4/04 | C-P210N | P21000718 | ex N6108W to VH-TUW cx 2/22 |
SCJ | 1 | 10/04 | Jodel D18 | 05-49 | current |
SCM | 1 | 5/20 | Vans RV12 | 120905 | (f/f 5/21) current |
SCN | 1 | 8/17 | Alpi Pioneer 300 | 332 | rereg ZK-DMK cx 10/21 |
SCR | 1 | 12/04 | Thunder & Colt AX8-105-S2 HAB | 2123USA | ex N410TC export cx 3/14 |
SCT | 1 | 3/10 | Best Off Skyranger Swift | 796 | current |
SDA | 1 | 8/94 | SA227AC | AC-641 | ex N351AE/N2683U to VH-SEF cx 2/02 then cx wfu 4/19 |
SDA | 2 | 3/12 | C182N | 18260961 | ex N7321Q to VH-SDZ cx 11/18 |
SDB | 1 | 7/15 | C208B | 208B2089 | ex N988BA/N52623 (op Gt Barrier) current |
SDC | 1 | 1/18 | C208B | 208B2057 | ex N2057/OB-1903-P/OB-1903-T/N5264M (op Gt Barrier) current |
SDD | 1 | 10/18 | C208B | 208B2087 | ex ZK-SAW/N771AL (op Great Barrier) current |
SDE | 1 | 9/21 | C208B | 208B2003 | ex ZK-MCS/N263SW/D-FAAJ/N208AE (op Great Barrier) current |
SDF | 1 | 8/08 | PAC 750XL | 145 | current |
SDG | 1 | 7/94 | C-U206F | 03016 | ex VH-UWL/N2688Q/N2907Q to VH-FRQ cx 11/09 |
SDG | 2 | 10/22 | C208B | 208B2041 | ex F-HFTR (op Great Barrier) current |
SDH | 1 | 4/83 | Pa31-350 | 31-8052172 | ex N76HP/N45017 to VH-HSI cx 8/88 |
SDH | 2 | 10/20 | Be B200 | BB-1643 | ex VH-LWO/N23356 (op Skyline, Napier) current |
SDI | 1 | 1/08 | Stolp Starduster SA100 | 14 | ex N73R (marked "US Navy 2-F-7") current |
SDK | 1 | 8/95 | Quicksilver MXL2 | MAANZ/538 | dest cx 8/02 |
SDL | 1 | 2/15 | Sopwith Camel F1 rep | 3 | ex N6254 current b TVA, Masterton |
SDP | 1 | 6/95 | Micro B22 Bantam | 0133 | cr Tirau 1/14 still current |
SDQ | 1 | 11/90 | Lancair 235 | AACA/1060 | current |
SDR | 1 | 5/96 | Titan Tornado 2 | D95618COHK0193 | wfu cx 1/01 |
SDR | 2 | 7/18 | ICP MXP740 Savannah S | 16-06-54-0477 | current |
SDT | 1 | 12/06 | PAC 08-600 Cresco | 034 | ex VH-MOS/ZK-JOH rereg ZK-TPW cx 12/09 |
SDT | 2 | 12/09 | PAC 750XL | 122 | ex VH-NZJ/ZK-XLG/ZK-JAD ditched Lake Taupo 1/15 dest cx 6/15 |
SDT | 3 | 6/15 | PAL 750XL | 174 | ex ZK-KBK (op Skydive Taupo) current |
SDU | 1 | 6/94 | Denney Kitfox | 1114 | current |
SEA | 1 | 3/87 | Aero Gare Sea Hawk | AACA/175/2 | current |
SEB | 1 | 4/85 | Barnes Senrab Windy 2 | 001/MAANZ/345 | cx by CAA 6/98 |
SEB | 2 | 2/10 | Be B55 | TC-2228 | ex VH-BQF/N6051D to VH-8D8 cx 6/23 |
SEE | 1 | 3/04 | Ramphos | NZR1 | current |
SEL | 1 | 11/17 | Cameron N90 HAB | 6027 | ex N3048K current |
SEO | 1 | 5/08 | Vintage Aviator SE5A-1 | WA18 | (marked D3540/K) current b TVA, Masterton |
SER | 1 | 11/99 | Micro B-22J Bantam | 0151 | current |
SES | 1 | 12/07 | Vintage Aviator SE5A-1 | WA20 | (marked B507/A) current b TVA, Masterton |
SET | 1 | 1/78 | SE5A Replica | AACA/266 | ex (ZK-EDW) marked B4863 cx by CAA 5/98 (T&T Museum Wanaka 2/02-2019+) |
SET | 2 | 11/05 | AA-5A | AA5A-0324 | ex VH-SZU/N9924U cr Motiti Island 12/11 cx 6/16 |
SEU | 1 | 2/82 | C-207A | 00713 | ex ZK-EWC/N9639M to VH-TXB cx 5/12 |
SEV | 1 | 10/81 | C-207 | 00204 | ex F-OCQK/N1604U cr 1/02 Milford Sound cx 6/02 |
SEV | 2 | 3/07 | Vintage Aviator SE5A-1 | WA19 | (marked F5690) current b TVA, Masterton |
SEW | 1 | 1/83 | C-T207A | 00584 | ex N73394 to VH-JWA cx 6/09 |
SEX | 1 | 9/83 | C-T207A | 00609 | ex N73622 to VH-TJB cx 7/10 |
SEY | 1 | 7/85 | C-T207A | 00661 | ex N76012 to VH-JBA cx 7/09 |
SFA | 1 | 11/85 | C208 | 00051 | ex N9426F w/o Mt Robertson 1/96 cx 3/96 |
SFA | 2 | 11/01 | Seaflight-NZ Shearwater | 1 | (rereg ZK-TNZ cx 5/05 rest 10/09) current |
SFB | 1 | 11/85 | C208 | 00059 | ex N9461F cr 11/87 Haumuri Bluff, Kaikoura cx 5/88 |
SFB | 2 | 7/04 | Diamond DA20-C1 | C0026 | ex ZK-KTA to C-GXRU cx 9/21 |
SFC | 1 | 9/87 | Be B80 Excalibur 8800 | LD-502 | ex VH-XQA/TR-LUK to P2-MBA cx 6/89 |
SFC | 2 | 10/93 | Pa34-200T | 34-7770054 | ex VH-PZG/N7222F current |
SFD | 1 | 7/93 | EAA Acro Sport | AACA/486 | (res 2/84) ex (ZK-SJF) wfu cx 6/04 rest 10/04 rereg ZK-TMP |
SFD | 2 | 7/04 | Diamond DA20-C1 | C0041 | ex ZK-KTN/N241CL to C-GXQZ cx 9/21 |
SFE | 1 | 6/88 | BN2A-21 | 406 | ex VH-SBH/N59JA/G-BCKY cr 3/89 Northwest Bay cx 3/90 |
SFE | 2 | 3/03 | Diamond DA20-C1 | C0124 | ex N971CT cr Waiheke Island 3/06 cx 5/06 |
SFF | 1 | 1/90 | BN2A-III-3 | 1025 | ex N900TA/N903GD/N3850K/VH-BPB/G-BDOT wfu 91to G-BDOT cx 12/92 |
SFF | 2 | 3/03 | Diamond DA20-C1 | C0125 | ex N975CT to N912DA cx 5/21 |
SFG | 1 | 1/90 | BN2A-III-3 | 1039 | ex N902TA/N1FY/N401JA/G-BEDP wfu 91 to G-BEDP cx 12/92 |
SFG | 2 | 3/03 | Diamond DA20-C1 | C0127 | ex D-EHPW/N627DC to N915DA cx 5/21 |
SFH | 1 | 8/03 | Diamond DA40D | D4-037 | to G-CCXU cx 2/04 |
SFI | 1 | 12/03 | Diamond DA20-C1 | C0062 | ex C-GEPY to C-???? cx 9/21 |
SFJ | 1 | 12/03 | Diamond DA20-C1 | C0064 | ex C-GEPZ to C-GXGY cx 9/21 |
SFK | 1 | 10/93 | BN2A-6 | 236 | ex VH-CPG/OO-GVS/G-51-236 (op MountainAir >5/08 FlyMySky >10/21 Auckland Seaplanes/Waihiki Wings) current |
SFL | 1 | 3/02 | Fu-24 | 154 | ex VH-SFL/(VH-EQL)/ZK-DAJ current |
SFR | 1 | 2/87 | Hawker Sea Fury FB11 | 37723 | ex N43SF/IraqAF-326 (marked WJ232) to VH-SHF cx 5/01 |
SFW | 1 | 2/05 | Aerochute Dual Deluxe | 047 | ex ZK-JHD rereg ZK-CHS cx 10/07 |
SFX | 1 | 8/22 | Cub Crafters CCX-2000 | 141 | ex N426X current |
SGB | 1 | 3/23 | ICP Savannah S | 22-11-54-0914 | current |
SGC | 1 | 11/21 | MXP-740 Savannah S | 20-12-54-0750 | current |
SGH | 1 | 7/01 | C182P | 62007 | ex N182KL/N91485 current |
SGI | 1 | 12/20 | Aeroprskt A22LS | 391 | current |
SGM | 1 | 8/17 | Alpi Pioneer 300 | 5018 | ex ZK-LPL rereg ZK-NGS cx 8/20 |
SGM | 2 | 10/23 | ICP Savannah S | 21-05-54-0784 | current |
SGN | 1 | 11/02 | Percival P56 Provost T1 | PAC/F/226 | ex VH-OIL/G-BKHP/8060M/WW397 rereg ZK-PPP cx 6/11 |
SGO | 1 | 10/08 | Tecnam P2002 Sierra | 362 | cr Tararua Ranges 10/19 cx 11/19 |
SGQ | 1 | 2/81 | AT-6 Harvard IIA | 88-12032 | ex NZ1033/EX588/41-33561 current (b SVAS Masterton) |
SGS | 1 | 2/12 | Rans S-6S Coyote II | 01071793 | (res <9/08) current |
SGT | 1 | 12/18 | TB-20 | 2084 | ex VH-KMY/N121TR current |
SGW | 1 | 7/08 | C172P | 17274407 | ex N2059C/N52081 current |
SHA | 1 | 6/95 | Be 55 | TC-1323 | ex VH-ILW/N4090A export cx 11/01 scr Bankstown, Aus 2/02 |
SHB | 1 | 3/17 | Diamond DA42 | 42.354 | ex VH-FGC/OE-VPY current |
SHG | 1 | 12/96 | Pa18-150 | 18-7709098 | ex PK-SDG/N83609 cr Tauranga 7/03 cx 8/03 |
SHG | 2 | 11/06 | Alpi Pioneer 300 | 122 | ex ZK-SHL current |
SHH | 1 | 11/82 | BAe146-100 | E1005 | ex G-SCHH/G-BIAJ to G-SCHH cx 11/82 |
SHH | 2 | 6/20 | Rutan Varieze | 1823 | current |
SHL | 1 | 12/00 | Tecnam P96 Golf | 136 | rereg ZK-NOL(2) cx 5/02 then ZK-ROB |
SHL | 2 | 8/02 | Alpi Pioneer 300 | SG100-053 | rereg ZK-PKS cx 9/03 |
SHL | 3 | 4/03 | Alpi Pioneer 300 | NZ85 | rereg ZK-LPD cx 10/04 |
SHL | 4 | 2/05 | Alpi Pioneer 300 | 122 | rereg ZK-SHG cx 11/06 |
SHL | 5 | ?/14 | Cessna 172N | 17274010 | (noted 2/14) ex N5208K current |
SHN | 1 | 4/13 | Vans RV-7 | 73115 | (reserved <9/08) current |
SHT | 1 | 3/15 | AutoGyro MTOsport | M01178 | current |
SIA | 1 | 9/05 | Ce.185A | 1850427 | ex VH-SIA/VH-SIL/N1627Z current |
SID | 1 | 4/08 | C172S | 172S9523 | ex ZK-JPJ/N21637 rereg ZK-PRK cx 11/15 |
SID | 2 | 12/15 | C182T | 18281825 | ex ZK-KBL/N6034H rereg ZK-CBC cx 5/21 |
SID | 3 | 6/22 | C182T | 18283155 | ex N915FH current |
SIG | 1 | 8/82 | Quicksilver MX | MAANZ/108 | wfu cx 10/05 pres Rangitata Island |
SIH | 1 | 12/79 | Be-60 Duke | P-525 | ex N6065N to N60BE cx 12/84 then OH-BOY > N444WH >(N104FM) >N525GA |
SIM | 1 | 5/85 | Rotec Rally 3 | 010650 | cr 1/86 Heriot wfu scr cx 4/92 |
SIM | 2 | 8/05 | Van's RV-4 | 2816 | ex N493DC current |
SIO | 1 | 6/93 | Rans S-10 Sakota | 0393157/MAANZ/489 | cr 8/97 cx 12/97 reb rest 2/01 cr Forest Field 3/22 stil current |
SIR | 1 | 4/95 | Be76 | ME-22 | ex VH-JGP/N6629Y to VH-MKH cx 8/08 |
SIS | 1 | 11/03 | C152 | 15285334 | ex ZK-FNV/N68723 current |
SIT | 1 | 1/16 | ELA Aviacion ELA-07R | 01050510712 | ex G-YROE current |
SIX | 1 | 10/06 | Rans S-6ES Coyote II | 11051712-ES | current |
SJA | 1 | 1/86 | G-164B-20T (mod 11/92) | 770B | ex N69A cr & dbf Colyton 7/01 cx 9/01 |
SJB | 1 | 6/00 | B737-33R | 28868 | ex N963WP/N35135 (op Freedomair>ANZ 11/05) wfs Chchch 2/14 to N886CL cx 4/14 then CP-2921 |
SJC | 1 | 9/01 | B737-3U3 | 28738 | ex N308FL/(PK-GGK)/N6069R/(PK-GGN) (op Freedomair>ANZ) wfu 6/13 sold 8/13 (to CP-2815 cx 11/13 |
SJC | 2 | 6/20 | Vans RV6 | 24856 | ex VH-COB current |
SJE | 1 | 10/01 | B737-3K2 | 27635 | ex (ZK-NAL)/PH-TSZ (op Freedomair>ANZ 9/05) wfs stored 12/11 to XA-VIT cx 3/12 then 2-AVIT > EX-37015 |
SJF | 1 | res 2/84 | EAA Acrosport UL | AACA/486 | res ntu rereg ZK-SFD cx 7/93 |
SJF | 2 | 3/09 | Tecnam P92 Eaglet | 1204 | current |
SJG | 1 | 7/98 | Pa28-181 | 28-7690456 | ex ZK-FTZ/N362PB/N9632N to N808DC cx 10/00 |
SJG | 2 | 12/14 | Pa22-150 | 22-3292 | ex N3536P current |
SJK | 1 | 5/12 | C170B | 26744 | ex N4400B current |
SJL | 1 | 8/19 | Alpi Pioneer 300 | 400 | current |
SJM | 1 | 11/07 | Corby CM2 Kestrel | SP1234 | current |
SJR | 1 | 3/08 | Airborne Windsports Edge X582 | 582-697 | ex N489DN current |
SJS | 1 | 11/08 | Tecnam P2002 Sierra | 364 | rereg ZK-MLX cx 12/08 then ZK-SRG(2) same day! |
SJS | 2 | 12/08 | Tecnam P2002 Sierra | 295 | ex ZK-SRG(1) current |
SJW | 1 | 2/06 | Micro B22J Bantam | 06-0286 | current |
SKA | 1 | 9/96 | Sky Arrow 450T | 011 | ex I-3296 cr Inangahua Junction 3/09 dest cx 7/09 |
SKA | 2 | 1/14 | C208 | 20800524 | ex VH-SKH/SX-SKV/N30183 current |
SKB | 1 | 4/05 | C208 | 20800244 | ex VH-BSX/B-3610/N1286A (op Air Milford) current |
SKC | 1 | 2/12 | C162 | 16200172 | N6044U current |
SKD | 1 | 5/21 | C-A185F | 18502479 | ex N1759R current |
SKE | 1 | 1/07 | Best Off Sky Ranger | SKR 6511670 | current |
SKF | 1 | 8/94 | Fu24A-950 | 211 | ex YI-AHC/ZK-DZI to ZK-CMK(2) cx 6/98 |
SKF | 2 | 7/12 | AT-504 | 504-4015 | ex N8520L to VH-NUV cx 5/22 |
SKH | 1 | 12/02 | DHC-1 Chipmunk 22 | C1/0547 | ex G-BVBT/WK511 current |
SKI | 1 | 7/82 | Pa32-301T | 32-8124022 | ex N8361T to N177DF cx 7/99 |
SKI | 2 | 11/00 | Micro B22S Bantam | 0120 | ex ZK-TBG current |
SKL | 1 | 5/98 | C182S | 80125 | ex N9513S to VH-KJY cx 4/10 |
SKL | 2 | 8/11 | Be C90A | LJ-1372 | ex N454P/(N121EB)/N151JL/N1562V current |
SKM | 1 | 2/16 | C208 | 20800581 | ex N208NZ/N5163K (op Air Milford) current |
SKO | 1 | 5/04 | Sky Arrow 480T | 136 | ex ZK-CJW current |
SKP | 1 | 6/09 | Just Aircraft Renegade | JA169-07-08 | current |
SKR | 1 | 2/07 | Rand KR-2 UL | 8438 | current |
SKS | 1 | 7/08 | Aeros Ukraine Skyranger Swift | 815 | current |
SKT | 1 | 3/04 | C-U206G | U20606609 | ex CP-1783/N9684Z cr dbf Marsden Cove, Whangarei 3/10 dest cx 4/10 |
SKV | 1 | 11/03 | Best Off Skyranger | SKR 0308387 | current |
SKW | 1 | 2/86 | C-A185F | 185-02701 | ex N1044F current |
SKX | 0 | ||||
SKY | 1 | 10/81 | Viscount 802 | 168 | ex G-AOHT to (PK-?)/G-AOHT cx 3/82 |
SKY | 2 | 3/91 | C172D | 49882 | ex N2582Y wfu Pukekohe cx 10/97 |
SKY | 3 | 3/98 | Aerostar S-81A | 3008 | wfu cx 6/16 |
SKY | 4 | 12/17 | C208 | 20800605 | ex N253PV (op Air Milford) current |
SKZ | 1 | 10/12 | C-U206F | U20602687 | ex VH-TIB/N350AQ current |
SLA | 1 | 11/03 | B737-377 | 23653 | ex YR-BAC/ZK-SLA/VH-CZA (leased as YR-BAC cx 8/05 rest 7/12) op Airwork lsd Alliance, Perth 9/12 overhaul 12/13-7/14 to YR-BAC cx 8/14 |
SLA | 2 | 7/19 | C208B | 208B2317 | ex N9023W (op Southern Lakes, Queenstown lsd to Gt Barrier) current |
SLC | 1 | 6/84 | C421B | 0940 | ex ZK-FID/RP-C7362/N5390J to N421AU cx 1/00 |
SLC | 2 | 8/23 | Pilatus PC-6/B2-H4 | 768 | ex Thai Govt 1314/HB-FGP current |
SLD | 1 | 11/17 | Gippsland GA8 Airvan | GA8-06-108 | ex VH-LPX/VH-BQR current |
SLF | 1 | 1/23 | Skycraft Scout Mk.III | PMC 2023 | current |
SLG | 1 | 5/91 | CP301 Emeraude | AACA/1087 | not completed cx 8/10 |
SLG | 2 | 10/14 | Aeroplane Factory Sling 2 LSA | 182 | current |
SLH | 1 | 5/05 | Jabiru J160 | 005 | (to VH-? cx 3/18 ntu rest 8/19) current |
SLI | 1 | 12/19 | Maule M-7-235 | 4034C | ex VH-KSQ/N5667F current |
SLK | 1 | 5/06 | Rand KR-2 UL | 2122 | current |
SLL | 1 | 9/07 | C182T | 18281084 | ex N818CF/N5169F current |
SLM | 1 | 11/13 | C180K | 18053016 | ex G-DAPH/N2620K current |
SLN | 1 | 3/22 | TAF Sling 4 TSi | 199SK | (ff 14/9/22) current |
SLO | 1 | 9/15 | Zenair CH701 STOL | 7-6442 | ex N80TN current |
SLP | 1 | 8/17 | PA32R-300 | 32R-7680459 | ex VH-HOK/N4561F current |
SLQ | 1 | 12/14 | Gippsland GA8 Airvan | GA8-03-040 | ex VH-FCK/ZK-TZT/ZK-KLC/VH-BQR current |
SLR | 1 | 11/08 | Jabiru J230 | 581 | current |
SLS | 1 | 8/77 | Maule M5-210C | 6188C | ex N434X current |
SLT | 1 | 4/95 | C172N | 67656 | ex VH-IXK/N1907C/N73757 current |
SLW | 1 | 12/15 | Gippsland GA-8 Airvan | GA08-08-136 | ex VH-AEA wfu 11/21 export (shipped to China) cx 1/22 |
SLX | 1 | 12/12 | Grimmer Skylux | 1005-2 | (dgd Waipawa 2/21) current |
SLY | 1 | 1/05 | TL-2000 Sting | 04ST100 | current |
SMB | 1 | 12/94 | P68C | 308 | ex G-JVJA/G-BMEI to VH-IOZ cx 3/18 |
SMB | 2 | 10/19 | Vans RV-12 UL | 121059 | current |
SMC | 1 | 3/94 | B-22 Bantam | 0129 | cr Seadown, Timaru 1/15 cx 2/15 |
SMC | 2 | 6/16 | Beech 300LW | FA-46 | ex VH-WCN/N888YY/N123AF/XC-LMV/XC-AA46/N123AF/N7222U to LV-HGK cx 11/17 |
SMC | 3 | 6/23 | PA-28R-200 | 28R-35606 | ex G-AYAC current |
SME | 1 | 7/00 | C182S | 80752 | to VH-SVA cx 10/02 |
SME | 2 | 8/06 | C185A | 1850438 | ex C-GEAD/N1638Z current b Omaka |
SMF | 1 | 8/09 | Titan T-51 Mustang | M05XXX50HK0057 | (Mazda engine) cr Matamata 10/16 dest cx 3/17 |
SMH | 1 | 2/99 | Avid Heavy Hauler UL | 745 | current |
SMI | 1 | 6/08 | Be76 | ME-151 | ex ZK-FIC/VH-HZG/N6018K current |
SMJ | 1 | 10/07 | Rand KR-2 | AACA/616 | wfu cx 8/14 |
SMK | 1 | 5/02 | Tecnam P96 Golf | 201 | to (VH-)24-7433 cx 3/10 |
SML | 1 | 7/09 | Dyn'Aero MCR-01 Club | 393 | cr Mount Duppa, Nelson 4/11 cx 5/11 |
SML | 2 | 3/20 | Alpi Pioneer 200 | 249-09 | ex ZK-KPD current |
SMP | 1 | 8/84 | C-R172K | 3317 | ex N758SE current |
SMR | 1 | 12/03 | Sequoia F8L Falco | 1230 | current |
SMS | 1 | 2/97 | C-A185E | 02041 | ex C-FCJS/N70185 dgd 8/22 nr Murchison still current |
SMW | 1 | 10/05 | C185C | 185-0678 | ex VH-CMW/P2-SEN/P2-CMW/VH-CMW/N2678Z (dgd 07 reb in Aus flew back 8/08) dgd Omarama 3/10 cx 5/19 |
SND | 1 | 10/06 | Monnet Sonerai IILS | 12/202-0565 | current |
SNE | 1 | 4/79 | Pa28-180B | 28-1509 | ex G-ASNE current |
SNG | 1 | 10/16 | Monnet Sonerai 1UL | 06571 | current |
SNI | 1 | 3/13 | Vintage Aviator Sopwith 7F-1 Snipe rep | 0112 | marked F2367 to G-CKBB cx 3/17 |
SNJ | 1 | 11/12 | Monnett Sonerai IILS | 62592265 | current |
SNM | 1 | 6/94 | Pa24-260C | 24-4851 | ex VH-CVY/N9714N to VH-EKB cx 8/04 |
SNM | 2 | 3/10 | Be C90A | LJ-1127 | ex N814CP/(N779JM)/PT-OXH/N7254B to ZS-TSM cx 5/14 |
SNO | 1 | 10/95 | Air Tractor AT-502B | 502B-0265 | ex VH-AQC to VH-SNA cx 5/98 |
SNP | 1 | 8/22 | Just Aircraft SuperSTOL | JA615-01-21 | current |
SNW | 1 | 11/07 | Monnet Sonerai IILS | 062592365 | current |
SNX | 1 | 10/00 | Sonex | 0096 | current |
SNZ | 1 | 6/88 | GAF N22B Nomad | 104 | ex VH-SNZ (wfu cx 10/97 rest 11/99) wfu cx 6/18 (st Taupo 2/19-11/22) |
SOC | 1 | 1/17 | TB20 | 2053 | ex G-RRFC/F-OILV current |
SOD | 1 | 12/04 | Foxcon Terrier 200 | NZ2004 | current |
SOL | 1 | 12/02 | Fisher Dakota Hawk | DH-20 | current |
SOM | 1 | 3/02 | Tecnam P96 Golf | 197 | to (VH-)24-4470 cx 12/05 |
SON | 1 | 12/03 | C152 | 15284105 | ex ZK-FJW/VH-HWK/N5481H current |
SOO | 1 | 12/23 | Sport Copter Vortex gyro | 030 | ex ZK-KJF/N31NT current |
SOP | 1 | 12/07 | Chad Wille Sopwith Triplane Replica | 533 | (marked N533/C) current b TVA Masterton |
SOR | 1 | ?/? | Solo Wings Windlass Aquilla | WA848 | current |
SOW | 1 | 12/03 | C-185A | 185-0504RR | ex ZK-CVF/ZK-CTN/ZK-CCL/N11B/(N2504Z) rereg ZK-MIT cx 12/12 |
SOX | 1 | 12/20 | ICP MXP-740 Savannah S | 18-02-54-0593 | current |
SPA | 1 | 10/94 | C177B | 02494 | ex VH-TXX/N18219 to VH-TXX cx 12/01 |
SPC | 1 | 4/99 | Murphy Maverick | 114M | dbs 9/02 (dbs Hamilton 9/02 stored) cx 4/11 |
SPD | 1 | 3/12 | Zenair CH601HD | 6-3884 | (res since <1/04) current |
SPE | 1 | 9/87 | Be58 | TH-1245 | ex N3861M to VH-JWP cx 10/88 |
SPG | 1 | 6/10 | Alpha R2160 | 160A-0019 | ex (ZK-CTD) to HS-IAG cx 8/18 |
SPH | 1 | 10/09 | Pfeifer Sopwith Scout rep | 101 | ex N54T (marked A6192) current b Omaka |
SPI | 1 | 11/08 | V-S Spitfire IX | CBAF.IX3128 | ex UB424/IDFAF20-80/ MM4014/PV270 (marked "PV270/AL" callsign 'Spitfire AL') current b Omaka |
SPK | 1 | 9/02 | Micro B22J Bantam | 02-0203 | cr Thames 12/02 cx 6/03 |
SPL | 1 | 6/97 | Pa32R-300 | 32R-7780335 | ex G-FSPL/(G-BFAO)/D-EILI/N4587Q to VH-LAZ cx 5/07 |
SPN | 1 | 5/06 | R2160 | 164 | ex EC-HLF/SX-ACJ/(F-GOJC)/TS-AJC/TU-TJC/F-ODJC current |
SPO | 1 | 9/06 | Glasair Sportsman 2+2 | 7071 | current |
SPR | 1 | 5/10 | TL-3000 Sirius | 10SI-12 | export cx 6/16 |
SPT | 1 | 9/10 | Spitfire Mk 26 | 070 | (res by 9/08) marked SP-T current |
SPW | 1 | 6/93 | Rans S-14 Airaile | 0892038 | wfu cx 2/22 |
SPY | 1 | 7/92 | Avid Flyer STOL | 874 | wfu cx 6/19 |
SPY | 2 | 11/23 | Ce 206H | 20608311 | ex VH-XBF/N6188L current |
SPZ | 1 | 4/15 | Glasair Sportsman 2+2 | 7422 | current |
SRB | 1 | 12/20 | Rans S-7 Courier | 0904375 | current |
SRC | 1 | 8/12 | PA31-325 | 31-7712075 | ex N27287/N219RA/N27287 (op Air Gisborne) current |
SRD | 1 | 3/21 | Rans S-7S Courier | 0904376 | current |
SRF | 1 | 8/09 | Zenair CH-601XL | 6-6971 | current |
SRG | 1 | 2/08 | Tecnam P2002 Sierra | 295 | rereg ZK-SJS(2) cx 12/08 |
SRG | 2 | 12/08 | Tecnam P2002 Sierra | 364 | ex ZK-MLX < ZK-SJS(1) (same day!) current |
SRI | 1 | 12/02 | C208B | 208B-0636 | ex N208PR/TG-RDC/N1038F current |
SRL | 1 | 1/07 | Cirrus SR20 | 1500 | ex VH-SRL/N321SN to VH-SRL cx 5/09 |
SRN | 1 | 12/09 | Sigma-4 | 11 | current |
SRP | 1 | 7/19 | Zenair Zodiac CH601-HD | 6-3021 | current |
SRR | 1 | 2/87 | Challenger II | MAANZ/375 | wfu cx 9/04 |
SRS | 1 | 8/08 | Best Off Skyranger Swift | 07 07 816 | current |
SRT | 1 | 1/07 | Cirrus SR20 | 1441 | ex ZK-VET(2)/N689CD to VH-DRK cx 5/07 |
SRT | 2 | 10/18 | ICP MXP-740 Savannah S | 15-09-54-0417 | current |
SRV | 1 | 3/96 | Vans RV6 | 20344 | current |
SRW | 1 | 11/98 | Micro B22 Bantam | 0146 | current |
SRX | 1 | 10/16 | C208B | 208B8285 | ex N9493 (op Air Safaris, Lake Tekapo) current |
SRY | 1 | 4/02 | Progressive Aerodyne Searey | 1MK-230 | current |
SRZ | 1 | 3/15 | TL-3000 Sirius | 15SI107 | current |
SSA | 1 | 4/12 | DH82A | DHA.111 | ex (VH-XGZ)/VH-SSA/A17-114 current |
SSE | 1 | 12/22 | Progressive Aerodyne Searey | IDK238 | current |
SSF | 1 | 8/00 | Zenair CH601UL | 3637 | rereg ZK-JPX cx 12/05 |
SSF | 2 | 1/06 | Zenair CH601XL | 6-9787 | current |
SSG | 1 | 12/97 | C152 | 85466 | ex ZK-FJU/VH-OWL/N1701C current |
SSH | 1 | 5/15 | Beech 300 | FL-328 | ex N823CF/EC-IBK/N4328W (op Skyline) current |
SSI | 1 | 3/92 | Campbell SkySki | MAANZ/470 | current |
SSM | 1 | 10/02 | Air Creation Clipper | 15414 | wfu cx 3/05 |
SSP | 1 | 4/04 | Cirrus SR22 | 0807 | (revoked cx 6/15 rest 2/20) current |
SSR | 1 | 11/06 | Yak-18T | 07-40 | ex LY-ATL current |
SSS | 1 | 6/79 | GA-7 Cougar | 0084 | ex N9526Z to ZK-TAD cx 12/96 |
SSS | 2 | 3/08 | Aero L-29 Delfin | 395192 | ex Romanian AF 56 (marked 56 red) dgd North Shore 23/09 cx 9/10 (nose section st Christchurch 3/14 disp Ashburton Museum 3/17-4/23+) |
SST | 1 | 10/10 | Vans RV-8 | 82081 | (res 9/08) current |
SSU | 1 | 3/08 | Aero L-29 Delfin | 395100 | ex Romanian AF 64 (marked "64 red" callsign 'Soviet 64') current |
SSW | 1 | 12/19 | C. Swanson Siemens Schuckert SSW D.IV rep | S-10 | ex N1094G (brown fuselage two white bands red rudder no serial) current |
STA | 1 | 1/08 | Jabiru J230UL | 474 | current |
STC | 1 | 8/98 | C182S | 80175 | ex N9472Z current |
STE | 1 | 10/19 | Zenair CH-701 STOL | 7-6120 | ex N73EX current |
STG | 1 | 6/82 | Be 58 | TH-1103 | ex N66910 to VH-HUG cx 9/86 |
STG | 2 | 6/04 | TL-2000 Sting | 03ST39 | ex ZK-VET current |
STK | 1 | 3/07 | Fly Synthesis Storch S | 411-355A | cr Gisborne 11/08 cx 10/09 |
STK | 2 | 11/12 | Zenair CH-701 STOL | 7-9507 | ex D-MEMO current |
STL | 1 | 1/06 | Zenair CH-701 STOL f/p amphib | 7-9777 | current |
STM | 1 | r7/94 | Boeing A75 Stearman | 75-5454 | ntu ex N75868/42-17291 (rem in USA) |
STM | 2 | 11/94 | Boeing A75 Stearman | 75-2724 | ex N53403/41-25235 current |
STN | 1 | 3/96 | Stinson 108-3 | 3585 | ex N585C/NC585C current |
STO | 1 | 3/14 | Slepcev Storch UL | 157 | current |
STP | 1 | 9/96 | Nanchang CJ-6 | 1232011 | ex PLAAFoC-76 (marked 1232011) current b Omaka |
STR | 1 | 4/11 | BAC 167 Strikemaster | EEP/JP/310 | ex VH-RBA/NZ6370/G-27-206 (marked NZ6370) to N187BA cx 1/17 |
STT | 1 | 8/05 | Tecnam P.2004 Bravo | 009 | to (VH-)24-8777 cx 8/12 |
STU | 1 | 10/84 | Robertson B1-RD | MAANZ/283 | cx by CAA 5/01 |
STU | 2 | 5/03 | Cirrus SR22 | 0423 | ex N753C to VH-JNT cx 3/08 then VH-DCI |
STU | 3 | 6/08 | Cirrus SR22 | 1900 | ex N588G/N57GL rereg ZK-PDR cx 5/15 |
STU | 4 | 9/15 | Vans RV-9A | 90612 | ex ZK-RVQ current |
STV | 1 | 12/04 | C421C | 421C0455 | ex N421NZ/F-OIAL/ZK-JBF/N6771C current |
STX | 1 | 1/10 | Pitts S-2B | 5090 | ex ZK-KHM/N86TW current |
SUA | 1 | 4/18 | ICP MXP-740 Savannah | 16-06-54-0476 | current |
SUB | 1 | res 3/94 | Lake La4-200 | 583 | res ex DQ-FDO (cx 7/84) ntu |
SUB | 2 | 8/00 | Fisher Dakota Hawk | DH-19 | to (VH-)19-4232 cx 7/04 |
SUE | 1 | 11/79 | Jodel D-11 | D5135 | ex (ZK-CZZ) current |
SUG | 1 | 9/93 | Pa25-235C (glider tug) | 25-4749 | ex VH-SUG/(VH-SPG)/N4950Y current |
SUH | 1 | 11/94 | B747-475 | 24896 | (op ANZ) (lsd from ILFC) ex N891LF/PP-VPI/N6009F/(C-FBCA) to USA for scrap cx 8/14 |
SUI | 1 | 4/95 | B747-441 | 24957 | (op ANZ) (lsd from ILFC) ex N821LF/PP-VPH to TF-AMX cx 10/10 to USA for scrap 2015 |
SUJ | 1 | 10/98 | B747-4F6 | 27602 | (op ANZ) (lsd from ILFC) ex N756PR to Tel Aviv 7/11 for freight conversion to N469AC cx 7/11 then TF-AMN (Air Atlanta/Magma) s.i.s 12/21 |
SUK | 1 | 11/07 | Sukhoi SU-29 | 75-01 | ex RA-3358K/N229RM/N1JW/RA-7501 to N229RM cx 1/18 |
SUM | 1 | 11/97 | C150J | 69904 | ex JA3463/N1895C/N51297 rereg ZK-EFD cx 5/06 |
SUN | 1 | 1/78 | Be A55 | TC-422 | ex CF-SUN cr 5/89 Waipunga cx 5/89 |
SUN | 2 | 12/93 | C-TU206A | 0511 | ex ZK-MAP/VH-AAM/(VH-DFU)/(N4811F) rereg ZK-PAI cx 7/04 |
SUN | 3 | 11/07 | Lockwood Aircam | AC073 | ex N417AC (cr Waiheke Island 1/08 reb) current |
SUP | 1 | 3/09 | Tekweld Supapup Mk 4 | 15 | current |
SUS | 1 | 5/10 | TL-3000 Sirius | 10SI-13 | rereg ZK-EBG cx 7/10 |
SUZ | 1 | 8/20 | PAC Cresco 08-600 | 40 | current |
SVA | 1 | 10/19 | ICP MXP-740 Savannah S | 14-11-54-0360 | current |
SVG | 1 | 1/19 | ICP MXP-740 Savannah | 05-06-51-395 | current |
SVH | 1 | 4/14 | ICP MXP-740 Savannah | 05-09-51-420 | ex ZK-WLH current |
SVI | 1 | 11/18 | C404 | 404-0693 | ex VH-ZUI/ZK-NDY/N6764D current |
SVK | 1 | 1/21 | ICP MXP-40 Savnnah S | 19-10-54-0695 | current |
SVQ | 1 | 8/15 | C402B | 402B0601 | ex VH-SVQ/VH-CXC/ZK-FXS/JA5237/N3743C current |
SVR | 1 | 10/17 | Dedalius Model 1 | 109-731-788 | current |
SVT | 1 | 2/08 | Tecnam P96 Golf | 303 | current |
SVY | 1 | 7/17 | Reims Ce F337F | 337-01385>F3370045 | ex VH-FCO/F-OCQO/N1785M current |
SWA | 1 | 12/83 | SA226TC | TC-256 | ex (ZK-MAA)/VH-SWN/N5460M to VH-WGY cx 6/86 to VH-ANJ/VH-MMY pres Australian Av Heritage Centre, Winnellie, NT |
SWA | 2 | 5/07 | PAC 750XL | 130 | ex ZK-JNV (survey conv) (op in PNG ferry to Perth, WA 7/09 retd NZ 12/12) current |
SWB | 1 | 2/84 | SA226AT | AT-033 | ex VH-CFO/(ZK-MAA)/VH-CFO/N1005Y cx 4/86 to VH-SWP cr 9/94 cx |
SWB | 2 | 1/04 | Zenair CH601HDS | 6-4401 | ex N447WB current |
SWC | 1 | 2/85 | SA226TC | TC-270 | ex VH-BPV/N5467M to VH-BIF cx 2/86 wfu 93 st Wangaratta pres Queensland Museum, Brisbane |
SWC | 2 | 6/17 | C150M | 15078198 | ex ZK-TAE/ZK-EFC/(ZS-JTC)/N9248U current b Tauranga Museum |
SWD | 1 | 5/85 | SA226TC | TC-287 | ex VH-BPG/N5657M to VH-WGV cx 4/86 |
SWG | 1 | 5/10 | PA28-181 | 2843389 | ex N24GK/N9515N/N4152R current |
SWJ | 1 | 10/93 | Rans S-10 Sakota | 1092145/MAANZ/495 | current |
SWK | 1 | 12/00 | Seawind 3000 | 148 | del to Aus 5/14 to VH-XSW cx 8/14 |
SWM | 1 | 2/17 | Progressive Aerodyne Searey LSA | 1018 | ex N415TA/N143SR current |
SWN | 1 | 8/11 | Alisport Silent Club | 09 | ex (F-)83VF current |
SWP | 1 | 1/95 | Pa22-150 | 22-7542 | ex VH-PAI cr Hope River Valley 1/08 still current |
SWR | 1 | 11/05 | DH89A | 6853 | ex D7(BelgAF)/NR777 (stored in Belgium since 1955 to NZ for rebuild 98) to D-IKFG cx 3/13 then >1/15 G-ZSWR >2/16 D-IKFG |
SWR | 2 | 5/17 | Autogyro MTO sport | MO1385 | current |
SWT | 1 | 8/90 | Seawind 2500 | AACA/1093 | cr Lake Taupo 1/05 to VH-? for reb cx 4/05 |
SWT | 2 | 4/22 | Vans RV-7A | 71724 | ex ZK-MEL/ZK-SDG current |
SWV | 1 | 11/17 | Tomark Aero Viper SD-4 | 035 | ex ZK-EAW/OM-M637 current |
SWW | 1 | 11/07 | Zenair CH-601XL | 6-4969 | current |
SWX | 1 | 1/18 | C172S | 172S10004 | ex ZK-XOX/N1609T current |
SWY | 1 | 12/06 | Alpha R2160 | 160A-06004 | ex (ZK-WCD(1)) (dgd Queenstown 11/08 repd) current |
SWZ | 1 | 11/06 | Alpha R2160 | 160A-06005 | current |
SXB | 1 | 10/12 | Be 77 | WA-139 | ex N96AW current |
SXC | 1 | 8/21 | AT-502A | 502A-3136 | ex N136MG (dgd Te Whanga 8/9/22 repaired 1/5/23) current |
SXG | 1 | 5/23 | AT 502A | 502A-3259 | ex N502TP current |
SXL | 1 | 10/20 | AT-602 | 602-1147 | ex N325BR current |
SXM | 1 | 9/20 | AT-502B | 502B-0633 | ex N9146H current |
SXN | 1 | 9/20 | AT-502B | 502B-2911 | ex N502LL current |
SXO | 1 | 8/21 | AT-602 | 602-1280 | ex N113AA dgd Mount White 4/22 repaired 8/23) current |
SXP | 1 | 7/19 | AT-502A | 502A-3192 | ex VH-XPN current |
SXR | 1 | 6/18 | Sonex | 1531 | current |
SXS | 1 | 12/21 | AT-602 | 602-1290 | ex N290GJ current |
SXT | 1 | 10/20 | AT-502A | 502A-3046 | ex N502TD current |
SXY | 1 | 2/07 | Alpha R2160i | 160Ai-07007 | to G-ILUA cx 5/07 |
SXY | 2 | 9/07 | Alpha R2120U | 120T-0001 | to G-ECAC cx 12/07 |
SXY | 3 | 1/08 | Alpha R2160 | 160A-0017 | to VH-ZXI cx 7/08 |
SXY | 4 | 3/09 | CzAW Sportcruiser | 09SC246 | rereg ZK-MBD cx 12/09 |
SXY | 5 | 12/09 | CzAW Sportcruiser | 09SC265 | rereg ZK-LED cx 4/16 |
SYD | 1 | 7/93 | Micro B22 Bantam | 0124 | rereg ZK-JQU cx 10/06 |
SYD | 2 | 11/06 | Alpi Pioneer 200 | 2020 | current |
SYR | 1 | 1/11 | Evans VP-1 | AACA/55/122/1 | ex ZK-DGC current |
SZC | 1 | 10/19 | C182P | 18265150 | ex VH-SZC/N7359S curent |
Continue to ZK-TAA to THZ
Back to NZ Register Index